C17H17ClN2O4 — CID 8730513
(2S)-2-(4-acetyl-2-methoxyphenoxy)-N-(2-chloro-3-pyridinyl)propanamide (PubChem CID 8730513) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is (2S)-2-(4-acetyl-2-methoxyphenoxy)-N-(2-chloro-3-pyridinyl)propanamide.
| Compound Name | (2S)-2-(4-acetyl-2-methoxyphenoxy)-N-(2-chloro-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 8730513 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2S)-2-(4-acetyl-2-methoxyphenoxy)-N-(2-chloro-3-pyridinyl)propanamide |
| SMILES | COc1cc(C(C)=O)ccc1O[C@@H](C)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H17ClN2O4/c1-10(21)12-6-7-14(15(9-12)23-3)24-11(2)17(22)20-13-5-4-8-19-16(13)18/h4-9,11H,1-3H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | QTDOYFXHYDUCLQ-NSHDSACASA-N |
| XLogP | 3.35 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|