C20H21ClN2O5 — CID 8741222
[(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 8741222) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8741222 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2cccnc2Cl)ccc1OC |
| InChI | InChI=1S/C20H21ClN2O5/c1-4-27-17-12-14(7-9-16(17)26-3)8-10-18(24)28-13(2)20(25)23-15-6-5-11-22-19(15)21/h5-13H,4H2,1-3H3,(H,23,25)/b10-8+/t13-/m0/s1 |
| InChIKey | HCNAIUJYYPQLIU-FROQITRMSA-N |
| XLogP | 3.73 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|