C17H13Cl3N2O3 — CID 8636808
[(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 8636808) has the molecular formula C17H13Cl3N2O3 and a molecular weight of 399.66 g/mol. Its IUPAC name is [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8636808 |
| Molecular Formula | C17H13Cl3N2O3 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(Cl)c(Cl)c1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H13Cl3N2O3/c1-10(17(24)22-14-3-2-8-21-16(14)20)25-15(23)7-5-11-4-6-12(18)13(19)9-11/h2-10H,1H3,(H,22,24)/b7-5+/t10-/m0/s1 |
| InChIKey | IJAZFVGNZSAUDC-STUBTGCMSA-N |
| XLogP | 4.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|