C18H17ClN2O3S — CID 8740033
[(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 8740033) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8740033 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CSc1ccc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2cccnc2Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O3S/c1-12(18(23)21-15-4-3-11-20-17(15)19)24-16(22)10-7-13-5-8-14(25-2)9-6-13/h3-12H,1-2H3,(H,21,23)/b10-7+/t12-/m0/s1 |
| InChIKey | KJSYAETWTSEGJS-PMDBQALLSA-N |
| XLogP | 4.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|