C21H16ClFN2O4 — CID 9385177
[(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate (PubChem CID 9385177) has the molecular formula C21H16ClFN2O4 and a molecular weight of 414.82 g/mol. Its IUPAC name is [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate.
| Compound Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 9385177 |
| Molecular Formula | C21H16ClFN2O4 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(-c2ccccc2F)o1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C21H16ClFN2O4/c1-13(21(27)25-17-7-4-12-24-20(17)22)28-19(26)11-9-14-8-10-18(29-14)15-5-2-3-6-16(15)23/h2-13H,1H3,(H,25,27)/b11-9+/t13-/m1/s1 |
| InChIKey | NNDLEPRMLOYTCV-YGNAEDSMSA-N |
| XLogP | 4.72 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|