C17H15Cl2NO4 — CID 42902660
[1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 42902660) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate.
| Compound Name | [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 42902660 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OC(C)C(=O)Nc2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C17H15Cl2NO4/c1-10-3-5-13(23-10)6-8-16(21)24-11(2)17(22)20-15-9-12(18)4-7-14(15)19/h3-9,11H,1-2H3,(H,20,22)/b8-6+ |
| InChIKey | LZVIKKOFMORFDW-SOFGYWHQSA-N |
| XLogP | 4.48 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|