C13H13Cl2NO3 — CID 7981052
[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-but-2-enoate (PubChem CID 7981052) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-but-2-enoate.
| Compound Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7981052 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@@H](C)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2NO3/c1-3-4-12(17)19-8(2)13(18)16-11-6-5-9(14)7-10(11)15/h3-8H,1-2H3,(H,16,18)/b4-3+/t8-/m0/s1 |
| InChIKey | SJCUGEMWTHQUKW-RTMURIBGSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|