C14H11Cl2NO4 — CID 2386762
[(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] furan-2-carboxylate (PubChem CID 2386762) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] furan-2-carboxylate.
| Compound Name | [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2386762 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] furan-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccco1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO4/c1-8(21-14(19)12-3-2-6-20-12)13(18)17-11-5-4-9(15)7-10(11)16/h2-8H,1H3,(H,17,18)/t8-/m1/s1 |
| InChIKey | CSUWZJCKOKZILO-MRVPVSSYSA-N |
| XLogP | 3.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |