C15H15ClFNO3 — CID 7779075
[(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 7779075) has the molecular formula C15H15ClFNO3 and a molecular weight of 311.74 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 7779075 |
| Molecular Formula | C15H15ClFNO3 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)O[C@@H](C)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H15ClFNO3/c1-3-4-5-6-14(19)21-10(2)15(20)18-13-8-7-11(17)9-12(13)16/h3-10H,1-2H3,(H,18,20)/b4-3+,6-5+/t10-/m0/s1 |
| InChIKey | QSENCBHGNMBNGD-POOPIXKXSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|