C18H13Cl2F2NO3 — CID 7736329
[(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate (PubChem CID 7736329) has the molecular formula C18H13Cl2F2NO3 and a molecular weight of 400.21 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7736329 |
| Molecular Formula | C18H13Cl2F2NO3 |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1c(F)cccc1Cl)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H13Cl2F2NO3/c1-10(18(25)23-16-7-5-11(21)9-14(16)20)26-17(24)8-6-12-13(19)3-2-4-15(12)22/h2-10H,1H3,(H,23,25)/b8-6+/t10-/m0/s1 |
| InChIKey | SSNCCEOKAWMQTF-PCGIRMHASA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|