C14H14ClFN2O4 — CID 7736361
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate (PubChem CID 7736361) has the molecular formula C14H14ClFN2O4 and a molecular weight of 328.73 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7736361 |
| Molecular Formula | C14H14ClFN2O4 |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)/C=C/c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H14ClFN2O4/c1-8(13(20)18-14(21)17-2)22-12(19)7-6-9-10(15)4-3-5-11(9)16/h3-8H,1-2H3,(H2,17,18,20,21)/b7-6+/t8-/m1/s1 |
| InChIKey | BNEXOBDUFABLNP-HYDMIIDASA-N |
| XLogP | 1.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|