C12H13BrN2O4S — CID 7712539
[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 7712539) has the molecular formula C12H13BrN2O4S and a molecular weight of 361.22 g/mol. Its IUPAC name is [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7712539 |
| Molecular Formula | C12H13BrN2O4S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | CNC(=O)NC(=O)[C@H](C)OC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C12H13BrN2O4S/c1-7(11(17)15-12(18)14-2)19-10(16)6-4-8-3-5-9(13)20-8/h3-7H,1-2H3,(H2,14,15,17,18)/b6-4+/t7-/m0/s1 |
| InChIKey | BXZAOJOXSNQAKT-KNIZRNDPSA-N |
| XLogP | 1.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|