C15H15ClN4O4 — CID 7734902
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate (PubChem CID 7734902) has the molecular formula C15H15ClN4O4 and a molecular weight of 350.76 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7734902 |
| Molecular Formula | C15H15ClN4O4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)/C=C/c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C15H15ClN4O4/c1-9(14(22)19-15(23)17-2)24-12(21)7-6-10-13(16)18-11-5-3-4-8-20(10)11/h3-9H,1-2H3,(H2,17,19,22,23)/b7-6+/t9-/m1/s1 |
| InChIKey | MZTFATMUJOHCGK-XCODYQFDSA-N |
| XLogP | 1.39 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|