C19H15ClN4O5 — CID 7734995
[(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate (PubChem CID 7734995) has the molecular formula C19H15ClN4O5 and a molecular weight of 414.81 g/mol. Its IUPAC name is [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7734995 |
| Molecular Formula | C19H15ClN4O5 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1c(Cl)nc2ccccn12)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15ClN4O5/c1-12(19(26)21-13-6-2-3-7-14(13)24(27)28)29-17(25)10-9-15-18(20)22-16-8-4-5-11-23(15)16/h2-12H,1H3,(H,21,26)/b10-9+/t12-/m1/s1 |
| InChIKey | DRXLLFXOILRYPL-BZYZDCJZSA-N |
| XLogP | 3.48 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|