C11H14BrNO2S — CID 115410076
(E)-3-(5-bromothiophen-2-yl)-N-(2-methylpropoxy)prop-2-enamide (PubChem CID 115410076) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(2-methylpropoxy)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-methylpropoxy)prop-2-enamide |
|---|---|
| PubChem CID | 115410076 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-methylpropoxy)prop-2-enamide |
| SMILES | CC(C)CONC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C11H14BrNO2S/c1-8(2)7-15-13-11(14)6-4-9-3-5-10(12)16-9/h3-6,8H,7H2,1-2H3,(H,13,14)/b6-4+ |
| InChIKey | XLUPBIGEAHHWQO-GQCTYLIASA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|