C14H18BrNO3S — CID 77024820
6-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]-4-methylhexanoic acid (PubChem CID 77024820) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is 6-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]-4-methylhexanoic acid.
| Compound Name | 6-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 77024820 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 6-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]-4-methylhexanoic acid |
| SMILES | CC(CCNC(=O)C=Cc1ccc(Br)s1)CCC(=O)O |
| InChI | InChI=1S/C14H18BrNO3S/c1-10(2-7-14(18)19)8-9-16-13(17)6-4-11-3-5-12(15)20-11/h3-6,10H,2,7-9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | RDWMOIIGXFYGHZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|