C15H22BrNOS — CID 102914567
(E)-3-(5-bromothiophen-2-yl)-N-(3-methyl-2-propan-2-ylbutyl)prop-2-enamide (PubChem CID 102914567) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(3-methyl-2-propan-2-ylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(3-methyl-2-propan-2-ylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 102914567 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(3-methyl-2-propan-2-ylbutyl)prop-2-enamide |
| SMILES | CC(C)C(CNC(=O)/C=C/c1ccc(Br)s1)C(C)C |
| InChI | InChI=1S/C15H22BrNOS/c1-10(2)13(11(3)4)9-17-15(18)8-6-12-5-7-14(16)19-12/h5-8,10-11,13H,9H2,1-4H3,(H,17,18)/b8-6+ |
| InChIKey | HJFIKNISQAHRME-SOFGYWHQSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|