C10H10BrNOS — CID 9442219
(E)-3-(5-bromothiophen-2-yl)-N-prop-2-enylprop-2-enamide (PubChem CID 9442219) has the molecular formula C10H10BrNOS and a molecular weight of 272.17 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 9442219 |
| Molecular Formula | C10H10BrNOS |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCNC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C10H10BrNOS/c1-2-7-12-10(13)6-4-8-3-5-9(11)14-8/h2-6H,1,7H2,(H,12,13)/b6-4+ |
| InChIKey | SOEVUUQDCDOSKN-GQCTYLIASA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|