C11H10BrN3OS — CID 77021941
3-(5-bromothiophen-2-yl)-N-(1H-imidazol-2-ylmethyl)prop-2-enamide (PubChem CID 77021941) has the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N-(1H-imidazol-2-ylmethyl)prop-2-enamide.
| Compound Name | 3-(5-bromothiophen-2-yl)-N-(1H-imidazol-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 77021941 |
| Molecular Formula | C11H10BrN3OS |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N-(1H-imidazol-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Br)s1)NCc1ncc[nH]1 |
| InChI | InChI=1S/C11H10BrN3OS/c12-9-3-1-8(17-9)2-4-11(16)15-7-10-13-5-6-14-10/h1-6H,7H2,(H,13,14)(H,15,16) |
| InChIKey | CRONBPMGPPHJTL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|