C18H19BrN2O3S2 — CID 76863683
3-(5-bromothiophen-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]prop-2-enamide (PubChem CID 76863683) has the molecular formula C18H19BrN2O3S2 and a molecular weight of 455.40 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]prop-2-enamide.
| Compound Name | 3-(5-bromothiophen-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 76863683 |
| Molecular Formula | C18H19BrN2O3S2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Br)s1)NCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H19BrN2O3S2/c19-17-9-5-15(25-17)6-10-18(22)20-13-14-3-7-16(8-4-14)26(23,24)21-11-1-2-12-21/h3-10H,1-2,11-13H2,(H,20,22) |
| InChIKey | ZFXHLAKHJNXGBA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|