C21H24ClN3O3S — CID 108759157
(E)-3-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]prop-2-enamide (PubChem CID 108759157) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108759157 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]prop-2-enamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(CNC(=O)/C=C/c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H24ClN3O3S/c1-24-12-14-25(15-13-24)29(27,28)20-9-4-18(5-10-20)16-23-21(26)11-6-17-2-7-19(22)8-3-17/h2-11H,12-16H2,1H3,(H,23,26)/b11-6+ |
| InChIKey | AJNKXFASZRSRAS-IZZDOVSWSA-N |
| XLogP | 2.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|