C18H25N3O3S — CID 108736056
(2E,4E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]hexa-2,4-dienamide (PubChem CID 108736056) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is (2E,4E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 108736056 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2E,4E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O3S/c1-3-4-5-6-18(22)19-15-16-7-9-17(10-8-16)25(23,24)21-13-11-20(2)12-14-21/h3-10H,11-15H2,1-2H3,(H,19,22)/b4-3+,6-5+ |
| InChIKey | HSDHZGAFRYQENT-VNKDHWASSA-N |
| XLogP | 1.37 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|