C21H24N4O3S — CID 171536240
N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]indole-1-carboxamide (PubChem CID 171536240) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]indole-1-carboxamide.
| Compound Name | N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 171536240 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]indole-1-carboxamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(CNC(=O)n3ccc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C21H24N4O3S/c1-23-12-14-24(15-13-23)29(27,28)19-8-6-17(7-9-19)16-22-21(26)25-11-10-18-4-2-3-5-20(18)25/h2-11H,12-16H2,1H3,(H,22,26) |
| InChIKey | FIWBRIAAEUJCCX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |