C22H24N4O4S — CID 171536131
5-(nitrosomethyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]indole-1-carboxamide (PubChem CID 171536131) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 5-(nitrosomethyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]indole-1-carboxamide.
| Compound Name | 5-(nitrosomethyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 171536131 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 5-(nitrosomethyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]indole-1-carboxamide |
| SMILES | O=NCc1ccc2c(ccn2C(=O)NCc2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H24N4O4S/c27-22(26-13-10-19-14-18(16-24-28)6-9-21(19)26)23-15-17-4-7-20(8-5-17)31(29,30)25-11-2-1-3-12-25/h4-10,13-14H,1-3,11-12,15-16H2,(H,23,27) |
| InChIKey | XIAKENRTBHQDCM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |