C24H28ClN3O3S — CID 20919093
N-[(4-chlorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide (PubChem CID 20919093) has the molecular formula C24H28ClN3O3S and a molecular weight of 474.03 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide |
|---|---|
| PubChem CID | 20919093 |
| Molecular Formula | C24H28ClN3O3S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide |
| SMILES | CCC(C(=O)NCc1ccc(Cl)cc1)n1ccc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C24H28ClN3O3S/c1-2-22(24(29)26-17-18-6-8-20(25)9-7-18)28-15-12-19-16-21(10-11-23(19)28)32(30,31)27-13-4-3-5-14-27/h6-12,15-16,22H,2-5,13-14,17H2,1H3,(H,26,29) |
| InChIKey | MCMIJPRMJAFVKL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |