C25H31N3O4S — CID 92706434
(2S)-N-[(2-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide (PubChem CID 92706434) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is (2S)-N-[(2-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide.
| Compound Name | (2S)-N-[(2-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide |
|---|---|
| PubChem CID | 92706434 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (2S)-N-[(2-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylindol-1-yl)butanamide |
| SMILES | CC[C@@H](C(=O)NCc1ccccc1OC)n1ccc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C25H31N3O4S/c1-3-22(25(29)26-18-20-9-5-6-10-24(20)32-2)28-16-13-19-17-21(11-12-23(19)28)33(30,31)27-14-7-4-8-15-27/h5-6,9-13,16-17,22H,3-4,7-8,14-15,18H2,1-2H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | PUKMHQGFZJJFBP-QFIPXVFZSA-N |
| XLogP | 4.09 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |