C25H31N3O4S — CID 92751320
(3R)-N-[(2-ethoxyphenyl)methyl]-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 92751320) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is (3R)-N-[(2-ethoxyphenyl)methyl]-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[(2-ethoxyphenyl)methyl]-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92751320 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (3R)-N-[(2-ethoxyphenyl)methyl]-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCOc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc3c(ccn3CC)c2)C1 |
| InChI | InChI=1S/C25H31N3O4S/c1-3-27-15-13-19-16-22(11-12-23(19)27)33(30,31)28-14-7-9-21(18-28)25(29)26-17-20-8-5-6-10-24(20)32-4-2/h5-6,8,10-13,15-16,21H,3-4,7,9,14,17-18H2,1-2H3,(H,26,29)/t21-/m1/s1 |
| InChIKey | VRZQPAKRCMRAPQ-OAQYLSRUSA-N |
| XLogP | 3.78 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |