C21H31N3O4S — CID 92726167
(3S)-N-(3-ethoxypropyl)-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 92726167) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is (3S)-N-(3-ethoxypropyl)-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-ethoxypropyl)-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92726167 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (3S)-N-(3-ethoxypropyl)-1-(1-ethylindol-5-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCOCCCNC(=O)[C@H]1CCCN(S(=O)(=O)c2ccc3c(ccn3CC)c2)C1 |
| InChI | InChI=1S/C21H31N3O4S/c1-3-23-13-10-17-15-19(8-9-20(17)23)29(26,27)24-12-5-7-18(16-24)21(25)22-11-6-14-28-4-2/h8-10,13,15,18H,3-7,11-12,14,16H2,1-2H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | GRARCRFQIFCGMP-SFHVURJKSA-N |
| XLogP | 2.60 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|