C26H33N3O4S — CID 20966244
1-(1-ethylindol-5-yl)sulfonyl-N-[(4-propan-2-yloxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 20966244) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 1-(1-ethylindol-5-yl)sulfonyl-N-[(4-propan-2-yloxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(1-ethylindol-5-yl)sulfonyl-N-[(4-propan-2-yloxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 20966244 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-(1-ethylindol-5-yl)sulfonyl-N-[(4-propan-2-yloxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCn1ccc2cc(S(=O)(=O)N3CCCC(C(=O)NCc4ccc(OC(C)C)cc4)C3)ccc21 |
| InChI | InChI=1S/C26H33N3O4S/c1-4-28-15-13-21-16-24(11-12-25(21)28)34(31,32)29-14-5-6-22(18-29)26(30)27-17-20-7-9-23(10-8-20)33-19(2)3/h7-13,15-16,19,22H,4-6,14,17-18H2,1-3H3,(H,27,30) |
| InChIKey | FIJUMLHLSDTQMG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |