C23H34N4O3S — CID 92751290
(3R)-1-(1-ethylindol-5-yl)sulfonyl-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide (PubChem CID 92751290) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is (3R)-1-(1-ethylindol-5-yl)sulfonyl-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(1-ethylindol-5-yl)sulfonyl-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92751290 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (3R)-1-(1-ethylindol-5-yl)sulfonyl-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide |
| SMILES | CCn1ccc2cc(S(=O)(=O)N3CCC[C@@H](C(=O)NCCN4CCCCC4)C3)ccc21 |
| InChI | InChI=1S/C23H34N4O3S/c1-2-26-15-10-19-17-21(8-9-22(19)26)31(29,30)27-14-6-7-20(18-27)23(28)24-11-16-25-12-4-3-5-13-25/h8-10,15,17,20H,2-7,11-14,16,18H2,1H3,(H,24,28)/t20-/m1/s1 |
| InChIKey | WXAIMQNIIPHCQD-HXUWFJFHSA-N |
| XLogP | 2.66 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |