C25H39N5O3S — CID 92751316
(3R)-1-(1-ethylindol-5-yl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 92751316) has the molecular formula C25H39N5O3S and a molecular weight of 489.69 g/mol. Its IUPAC name is (3R)-1-(1-ethylindol-5-yl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(1-ethylindol-5-yl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92751316 |
| Molecular Formula | C25H39N5O3S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (3R)-1-(1-ethylindol-5-yl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc4c(ccn4CC)c3)C2)CC1 |
| InChI | InChI=1S/C25H39N5O3S/c1-3-27-15-17-28(18-16-27)12-6-11-26-25(31)22-7-5-13-30(20-22)34(32,33)23-8-9-24-21(19-23)10-14-29(24)4-2/h8-10,14,19,22H,3-7,11-13,15-18,20H2,1-2H3,(H,26,31)/t22-/m1/s1 |
| InChIKey | OJZDOEBCOVTRSZ-JOCHJYFZSA-N |
| XLogP | 2.21 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|