C22H27N3O3S2 — CID 46349864
1-(1-ethylindol-5-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide (PubChem CID 46349864) has the molecular formula C22H27N3O3S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-(1-ethylindol-5-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-(1-ethylindol-5-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46349864 |
| Molecular Formula | C22H27N3O3S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-(1-ethylindol-5-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide |
| SMILES | CCn1ccc2cc(S(=O)(=O)N3CCCC(C(=O)NCCc4cccs4)C3)ccc21 |
| InChI | InChI=1S/C22H27N3O3S2/c1-2-24-13-10-17-15-20(7-8-21(17)24)30(27,28)25-12-3-5-18(16-25)22(26)23-11-9-19-6-4-14-29-19/h4,6-8,10,13-15,18H,2-3,5,9,11-12,16H2,1H3,(H,23,26) |
| InChIKey | TTYMMWSTUUGDMS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |