C22H31N3O3S — CID 93306232
[(3R)-1-(1-ethylindol-5-yl)sulfonylpiperidin-3-yl]-[(3S)-3-methylpiperidin-1-yl]methanone (PubChem CID 93306232) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is [(3R)-1-(1-ethylindol-5-yl)sulfonylpiperidin-3-yl]-[(3S)-3-methylpiperidin-1-yl]methanone.
| Compound Name | [(3R)-1-(1-ethylindol-5-yl)sulfonylpiperidin-3-yl]-[(3S)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 93306232 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [(3R)-1-(1-ethylindol-5-yl)sulfonylpiperidin-3-yl]-[(3S)-3-methylpiperidin-1-yl]methanone |
| SMILES | CCn1ccc2cc(S(=O)(=O)N3CCC[C@@H](C(=O)N4CCC[C@H](C)C4)C3)ccc21 |
| InChI | InChI=1S/C22H31N3O3S/c1-3-23-13-10-18-14-20(8-9-21(18)23)29(27,28)25-12-5-7-19(16-25)22(26)24-11-4-6-17(2)15-24/h8-10,13-14,17,19H,3-7,11-12,15-16H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | MCWROQGCTSFYFI-PKOBYXMFSA-N |
| XLogP | 3.32 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |