C20H29N3O4S — CID 92751303
(3S)-1-(1-ethylindol-5-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide (PubChem CID 92751303) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is (3S)-1-(1-ethylindol-5-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(1-ethylindol-5-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92751303 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (3S)-1-(1-ethylindol-5-yl)sulfonyl-N-(3-methoxypropyl)piperidine-3-carboxamide |
| SMILES | CCn1ccc2cc(S(=O)(=O)N3CCC[C@H](C(=O)NCCCOC)C3)ccc21 |
| InChI | InChI=1S/C20H29N3O4S/c1-3-22-12-9-16-14-18(7-8-19(16)22)28(25,26)23-11-4-6-17(15-23)20(24)21-10-5-13-27-2/h7-9,12,14,17H,3-6,10-11,13,15H2,1-2H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | ZGKPLGRTUNMYTQ-KRWDZBQOSA-N |
| XLogP | 2.21 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|