C17H26N2O3S — CID 51198880
2,2-dimethyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide (PubChem CID 51198880) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 51198880 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2,2-dimethyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)16(20)18-13-14-7-9-15(10-8-14)23(21,22)19-11-5-4-6-12-19/h7-10H,4-6,11-13H2,1-3H3,(H,18,20) |
| InChIKey | MOQUGSVDVIJOFO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |