C21H29N3O6S2 — CID 55650330
5-(tert-butylsulfamoyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide (PubChem CID 55650330) has the molecular formula C21H29N3O6S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55650330 |
| Molecular Formula | C21H29N3O6S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NCc2ccc(S(=O)(=O)N3CCCCC3)cc2)o1 |
| InChI | InChI=1S/C21H29N3O6S2/c1-21(2,3)23-31(26,27)19-12-11-18(30-19)20(25)22-15-16-7-9-17(10-8-16)32(28,29)24-13-5-4-6-14-24/h7-12,23H,4-6,13-15H2,1-3H3,(H,22,25) |
| InChIKey | ZTFHXFKUPFHCBE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |