C20H18F6N2O3S — CID 108759301
N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 108759301) has the molecular formula C20H18F6N2O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108759301 |
| Molecular Formula | C20H18F6N2O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCCC2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F6N2O3S/c21-19(22,23)15-9-14(10-16(11-15)20(24,25)26)18(29)27-12-13-3-5-17(6-4-13)32(30,31)28-7-1-2-8-28/h3-6,9-11H,1-2,7-8,12H2,(H,27,29) |
| InChIKey | VTVFHJRSJOBUSQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |