C18H21N3O3S — CID 119735910
3-amino-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide (PubChem CID 119735910) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-amino-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide.
| Compound Name | 3-amino-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 119735910 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-amino-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide |
| SMILES | Nc1cccc(C(=O)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C18H21N3O3S/c19-16-5-3-4-15(12-16)18(22)20-13-14-6-8-17(9-7-14)25(23,24)21-10-1-2-11-21/h3-9,12H,1-2,10-11,13,19H2,(H,20,22) |
| InChIKey | FJJQPIABNQPHDR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|