C25H26N2O3S — CID 46385970
N-benzyl-3-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 46385970) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is N-benzyl-3-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | N-benzyl-3-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 46385970 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-benzyl-3-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(NCc1ccccc1)c1cccc(-c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C25H26N2O3S/c28-25(26-19-20-8-3-1-4-9-20)23-11-7-10-22(18-23)21-12-14-24(15-13-21)31(29,30)27-16-5-2-6-17-27/h1,3-4,7-15,18H,2,5-6,16-17,19H2,(H,26,28) |
| InChIKey | DTESUIXPVUCXOU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |