C13H15F3N2O3S — CID 108759219
2,2,2-trifluoro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]acetamide (PubChem CID 108759219) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 108759219 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]acetamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)12(19)17-9-10-3-5-11(6-4-10)22(20,21)18-7-1-2-8-18/h3-6H,1-2,7-9H2,(H,17,19) |
| InChIKey | JAGFYEMTLPQDPW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |