C22H22N2O3S — CID 94042960
N-(naphthalen-2-ylmethyl)-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 94042960) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-(naphthalen-2-ylmethyl)-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(naphthalen-2-ylmethyl)-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 94042960 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(naphthalen-2-ylmethyl)-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCc1ccc2ccccc2c1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c25-22(23-16-17-7-8-18-5-1-2-6-20(18)15-17)19-9-11-21(12-10-19)28(26,27)24-13-3-4-14-24/h1-2,5-12,15H,3-4,13-14,16H2,(H,23,25) |
| InChIKey | VJGUKOHYZUQIHB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |