C26H25N3O4S — CID 16867447
N-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 16867447) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 16867447 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCc1cc(-c2ccc3ccccc3c2)on1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H25N3O4S/c30-26(20-10-12-24(13-11-20)34(31,32)29-14-4-1-5-15-29)27-18-23-17-25(33-28-23)22-9-8-19-6-2-3-7-21(19)16-22/h2-3,6-13,16-17H,1,4-5,14-15,18H2,(H,27,30) |
| InChIKey | DIDJJPHAGLGZNU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |