C20H27N3O3S2 — CID 56558410
4-(azepan-1-ylsulfonyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 56558410) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 56558410 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | CC(C)c1nc(CNC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)cs1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-15(2)20-22-17(14-27-20)13-21-19(24)16-7-9-18(10-8-16)28(25,26)23-11-5-3-4-6-12-23/h7-10,14-15H,3-6,11-13H2,1-2H3,(H,21,24) |
| InChIKey | AMNBGTQDNGSITG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |