C22H26N4O2S2 — CID 56561374
1-N,4-N-bis[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzene-1,4-dicarboxamide (PubChem CID 56561374) has the molecular formula C22H26N4O2S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-N,4-N-bis[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56561374 |
| Molecular Formula | C22H26N4O2S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-N,4-N-bis[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzene-1,4-dicarboxamide |
| SMILES | CC(C)c1nc(CNC(=O)c2ccc(C(=O)NCc3csc(C(C)C)n3)cc2)cs1 |
| InChI | InChI=1S/C22H26N4O2S2/c1-13(2)21-25-17(11-29-21)9-23-19(27)15-5-7-16(8-6-15)20(28)24-10-18-12-30-22(26-18)14(3)4/h5-8,11-14H,9-10H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | NXFBYLYICMXJSV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |