C19H24N2O2S — CID 56557686
4-cyclopentyloxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 56557686) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 4-cyclopentyloxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 56557686 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-cyclopentyloxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | CC(C)c1nc(CNC(=O)c2ccc(OC3CCCC3)cc2)cs1 |
| InChI | InChI=1S/C19H24N2O2S/c1-13(2)19-21-15(12-24-19)11-20-18(22)14-7-9-17(10-8-14)23-16-5-3-4-6-16/h7-10,12-13,16H,3-6,11H2,1-2H3,(H,20,22) |
| InChIKey | HOVPTXYRGHWFPN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |