C16H20N2O3S — CID 110728064
3,5-dimethoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 110728064) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110728064 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3,5-dimethoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCc2csc(C(C)C)n2)c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-10(2)16-18-12(9-22-16)8-17-15(19)11-5-13(20-3)7-14(6-11)21-4/h5-7,9-10H,8H2,1-4H3,(H,17,19) |
| InChIKey | IQTZRHPHGVBDSV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |