C11H18N2OS — CID 110728040
N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]butanamide (PubChem CID 110728040) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]butanamide.
| Compound Name | N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110728040 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]butanamide |
| SMILES | CCCC(=O)NCc1csc(C(C)C)n1 |
| InChI | InChI=1S/C11H18N2OS/c1-4-5-10(14)12-6-9-7-15-11(13-9)8(2)3/h7-8H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | HVVQMHOSDVPAIH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |