C9H13ClN2OS — CID 166403785
2-chloro-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]acetamide (PubChem CID 166403785) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 2-chloro-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 166403785 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-chloro-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]acetamide |
| SMILES | CC(C)c1nc(CNC(=O)CCl)cs1 |
| InChI | InChI=1S/C9H13ClN2OS/c1-6(2)9-12-7(5-14-9)4-11-8(13)3-10/h5-6H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | JIRXZGILMFYJAH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|