C10H17N3OS — CID 115919637
3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]propanamide (PubChem CID 115919637) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]propanamide.
| Compound Name | 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 115919637 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]propanamide |
| SMILES | CC(C)c1nc(CNCCC(N)=O)cs1 |
| InChI | InChI=1S/C10H17N3OS/c1-7(2)10-13-8(6-15-10)5-12-4-3-9(11)14/h6-7,12H,3-5H2,1-2H3,(H2,11,14) |
| InChIKey | LAKHSDBIXYRXNZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|