C11H21ClN2OS — CID 115589584
3-methoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine;hydrochloride (PubChem CID 115589584) has the molecular formula C11H21ClN2OS and a molecular weight of 264.82 g/mol. Its IUPAC name is 3-methoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-methoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115589584 |
| Molecular Formula | C11H21ClN2OS |
| Molecular Weight | 264.82 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-methoxy-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine;hydrochloride |
| SMILES | COCCCNCc1csc(C(C)C)n1.Cl |
| InChI | InChI=1S/C11H20N2OS.ClH/c1-9(2)11-13-10(8-15-11)7-12-5-4-6-14-3;/h8-9,12H,4-7H2,1-3H3;1H |
| InChIKey | VJQYCWDKNIZHEM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|